EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:39414 - benzilic acid
| Formula | C14H12O3 |
| Net Charge | 0 |
| Average Mass | 228.247 |
| Monoisotopic Mass | 228.07864 |
| SMILES | O=C(O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O3/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,17H,(H,15,16) |
| InChIKey | UKXSKSHDVLQNKG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzilic acid (CHEBI:39414) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| Incoming Relation(s) |
| 4,4'-dichlorobenzilic acid (CHEBI:39413) has functional parent benzilic acid (CHEBI:39414) |
| clidinium (CHEBI:3743) has functional parent benzilic acid (CHEBI:39414) |
| clidinium bromide (CHEBI:3744) has functional parent benzilic acid (CHEBI:39414) |
| IUPAC Name |
|---|
| hydroxy(diphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| diphenylglycolic acid | ChemIDplus |
| α-phenylmandelic acid | NIST Chemistry WebBook |
| α-hydroxy-2,2-diphenylacetic acid | ChemIDplus |
| 2-hydroxy-2,2-diphenylacetic acid | NIST Chemistry WebBook |
| α,α-diphenylglycolic acid | NIST Chemistry WebBook |
| α,α-diphenyl-α-hydroxyacetic acid | NIST Chemistry WebBook |