EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3743 - clidinium
| Formula | C22H26NO3 |
| Net Charge | +1 |
| Average Mass | 352.454 |
| Monoisotopic Mass | 352.19072 |
| SMILES | C[N@+]12CC[C@H](CC1)C(OC(=O)C(O)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C22H26NO3/c1-23-14-12-17(13-15-23)20(16-23)26-21(24)22(25,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,17,20,25H,12-16H2,1H3/q+1/t17-,20?,23+ |
| InChIKey | HOOSGZJRQIVJSZ-NNBUQUNQSA-N |
| Roles Classification |
|---|
| Biological Role: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| Applications: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clidinium (CHEBI:3743) has functional parent 3-quinuclidinol (CHEBI:115239) |
| clidinium (CHEBI:3743) has functional parent benzilic acid (CHEBI:39414) |
| clidinium (CHEBI:3743) has role anti-arrhythmia drug (CHEBI:38070) |
| clidinium (CHEBI:3743) has role antispasmodic drug (CHEBI:53784) |
| clidinium (CHEBI:3743) has role parasympatholytic (CHEBI:50370) |
| clidinium (CHEBI:3743) is a carboxylic ester (CHEBI:33308) |
| clidinium (CHEBI:3743) is a organic cation (CHEBI:25697) |
| clidinium (CHEBI:3743) is a quaternary ammonium ion (CHEBI:35267) |
| Incoming Relation(s) |
| clidinium bromide (CHEBI:3744) has part clidinium (CHEBI:3743) |
| IUPAC Name |
|---|
| 3-{[hydroxy(diphenyl)acetyl]oxy}-1-methyl-1-azoniabicyclo[2.2.2]octane |
| Synonyms | Source |
|---|---|
| 3-(2-Hydroxy-2,2-diphenyl-acetoxy)-1-methyl-1-azonia-bicyclo[2.2.2]octane | ChEMBL |
| 3-hydroxy-1-methylquinuclidinium benzilate ester | ChemIDplus |
| Clidinium | KEGG COMPOUND |
| CLIDINIUM | ChEMBL |
| Clidinium cation | ChEMBL |
| Clidinium ion | ChEMBL |
| Citations |
|---|