EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26NO3 |
| Net Charge | +1 |
| Average Mass | 352.454 |
| Monoisotopic Mass | 352.19072 |
| SMILES | C[N@+]12CC[C@H](CC1)C(OC(=O)C(O)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C22H26NO3/c1-23-14-12-17(13-15-23)20(16-23)26-21(24)22(25,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,17,20,25H,12-16H2,1H3/q+1/t17-,20?,23+ |
| InChIKey | HOOSGZJRQIVJSZ-NNBUQUNQSA-N |
| Roles Classification |
|---|
| Biological Role: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clidinium (CHEBI:3743) has functional parent 3-quinuclidinol (CHEBI:115239) |
| clidinium (CHEBI:3743) has functional parent benzilic acid (CHEBI:39414) |
| clidinium (CHEBI:3743) has role anti-arrhythmia drug (CHEBI:38070) |
| clidinium (CHEBI:3743) has role antispasmodic drug (CHEBI:53784) |
| clidinium (CHEBI:3743) has role parasympatholytic (CHEBI:50370) |
| clidinium (CHEBI:3743) is a carboxylic ester (CHEBI:33308) |
| clidinium (CHEBI:3743) is a organic cation (CHEBI:25697) |
| clidinium (CHEBI:3743) is a quaternary ammonium ion (CHEBI:35267) |
| Incoming Relation(s) |
| clidinium bromide (CHEBI:3744) has part clidinium (CHEBI:3743) |
| IUPAC Name |
|---|
| 3-{[hydroxy(diphenyl)acetyl]oxy}-1-methyl-1-azoniabicyclo[2.2.2]octane |
| Synonyms | Source |
|---|---|
| 3-(2-Hydroxy-2,2-diphenyl-acetoxy)-1-methyl-1-azonia-bicyclo[2.2.2]octane | ChEMBL |
| 3-hydroxy-1-methylquinuclidinium benzilate ester | ChemIDplus |
| Clidinium | KEGG COMPOUND |
| CLIDINIUM | ChEMBL |
| N-methyl quinuclidinyl benzilate | ChemIDplus |