EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C22H26NO3 |
| Net Charge | 0 |
| Average Mass | 432.358 |
| Monoisotopic Mass | 431.10961 |
| SMILES | C[N@+]12CC[C@H](CC1)C(OC(=O)C(O)(c1ccccc1)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C22H26NO3.BrH/c1-23-14-12-17(13-15-23)20(16-23)26-21(24)22(25,18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,17,20,25H,12-16H2,1H3;1H/q+1;/p-1/t17-,20?,23+; |
| InChIKey | GKEGFOKQMZHVOW-KUTGSRRKSA-M |
| Roles Classification |
|---|
| Biological Role: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clidinium bromide (CHEBI:3744) has functional parent 3-quinuclidinol (CHEBI:115239) |
| clidinium bromide (CHEBI:3744) has functional parent benzilic acid (CHEBI:39414) |
| clidinium bromide (CHEBI:3744) has part clidinium (CHEBI:3743) |
| clidinium bromide (CHEBI:3744) has role anti-arrhythmia drug (CHEBI:38070) |
| clidinium bromide (CHEBI:3744) has role antispasmodic drug (CHEBI:53784) |
| clidinium bromide (CHEBI:3744) has role parasympatholytic (CHEBI:50370) |
| clidinium bromide (CHEBI:3744) is a organic bromide salt (CHEBI:48369) |
| clidinium bromide (CHEBI:3744) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 3-{[hydroxy(diphenyl)acetyl]oxy}-1-methyl-1-azoniabicyclo[2.2.2]octane bromide |
| INNs | Source |
|---|---|
| bromure de clidinium | ChemIDplus |
| bromuro de clidinio | ChemIDplus |
| clidinii bromidum | ChemIDplus |
| clidinium bromide | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-methyl-3-(benziloyloxy)quinuclidinium bromide | ChemIDplus |
| 3-(2,2-diphenyl-2-hydroxyethanoyloxy)-quinuclidinium bromide | ChemIDplus |
| 3-(benziloyloxy)-1-methylquinuclidinium bromide | ChemIDplus |
| (±)-3-hydroxy-1-methylquinuclidinium bromide benzilate | ChemIDplus |
| 3-hydroxy-1-methylquinuclidinium bromide benzilate | ChemIDplus |
| quinuclidinol methylbromide, benzilate | ChemIDplus |