EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C22H26NO3 |
| Net Charge | 0 |
| Average Mass | 432.358 |
| Monoisotopic Mass | 431.10961 |
| SMILES | C[N@+]12CC[C@H](CC1)C(OC(=O)C(O)(c1ccccc1)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C22H26NO3.BrH/c1-23-14-12-17(13-15-23)20(16-23)26-21(24)22(25,18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,17,20,25H,12-16H2,1H3;1H/q+1;/p-1/t17-,20?,23+; |
| InChIKey | GKEGFOKQMZHVOW-KUTGSRRKSA-M |
| Roles Classification |
|---|
| Biological Role: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| Applications: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clidinium bromide (CHEBI:3744) has functional parent 3-quinuclidinol (CHEBI:115239) |
| clidinium bromide (CHEBI:3744) has functional parent benzilic acid (CHEBI:39414) |
| clidinium bromide (CHEBI:3744) has part clidinium (CHEBI:3743) |
| clidinium bromide (CHEBI:3744) has role anti-arrhythmia drug (CHEBI:38070) |
| clidinium bromide (CHEBI:3744) has role antispasmodic drug (CHEBI:53784) |
| clidinium bromide (CHEBI:3744) has role parasympatholytic (CHEBI:50370) |
| clidinium bromide (CHEBI:3744) is a organic bromide salt (CHEBI:48369) |
| clidinium bromide (CHEBI:3744) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 3-{[hydroxy(diphenyl)acetyl]oxy}-1-methyl-1-azoniabicyclo[2.2.2]octane bromide |
| INNs | Source |
|---|---|
| bromure de clidinium | ChemIDplus |
| bromuro de clidinio | ChemIDplus |
| clidinii bromidum | ChemIDplus |
| clidinium bromide | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-methyl-3-(benziloyloxy)quinuclidinium bromide | ChemIDplus |
| 3-(2,2-diphenyl-2-hydroxyethanoyloxy)-quinuclidinium bromide | ChemIDplus |
| 3-(benziloyloxy)-1-methylquinuclidinium bromide | ChemIDplus |
| (±)-3-hydroxy-1-methylquinuclidinium bromide benzilate | ChemIDplus |
| 3-hydroxy-1-methylquinuclidinium bromide benzilate | ChemIDplus |
| NSC-756686 | ChEMBL |
| Brand Name | Source |
|---|---|
| Clidinium bromide component of librax | ChEMBL |
| Citations |
|---|