EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10Cl2O3 |
| Net Charge | 0 |
| Average Mass | 297.137 |
| Monoisotopic Mass | 296.00070 |
| SMILES | O=C(O)C(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H10Cl2O3/c15-11-5-1-9(2-6-11)14(19,13(17)18)10-3-7-12(16)8-4-10/h1-8,19H,(H,17,18) |
| InChIKey | LXFMMUDXRIMBHN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4'-dichlorobenzilic acid (CHEBI:39413) has functional parent benzilic acid (CHEBI:39414) |
| 4,4'-dichlorobenzilic acid (CHEBI:39413) is a chlorocarboxylic acid (CHEBI:36685) |
| 4,4'-dichlorobenzilic acid (CHEBI:39413) is a monochlorobenzenes (CHEBI:83403) |
| 4,4'-dichlorobenzilic acid (CHEBI:39413) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| chloropropylate (CHEBI:39411) has functional parent 4,4'-dichlorobenzilic acid (CHEBI:39413) |
| IUPAC Name |
|---|
| bis(4-chlorophenyl)(hydroxy)acetic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2383632 | Beilstein |
| CAS:23851-46-9 | ChemIDplus |