EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O5 |
| Net Charge | 0 |
| Average Mass | 362.466 |
| Monoisotopic Mass | 362.20932 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1 |
| InChIKey | JYGXADMDTFJGBT-VWUMJDOOSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) | ||
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (2268561) | ||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). drug allergen Any drug which causes the onset of an allergic reaction. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | anti-asthmatic drug A drug used to treat asthma. anti-inflammatory drug A substance that reduces or suppresses inflammation. anti-allergic agent A drug used to treat allergic reactions. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cortisol (CHEBI:17650) has parent hydride pregnane (CHEBI:8386) |
| cortisol (CHEBI:17650) has role anti-allergic agent (CHEBI:50857) |
| cortisol (CHEBI:17650) has role anti-asthmatic drug (CHEBI:49167) |
| cortisol (CHEBI:17650) has role anti-inflammatory drug (CHEBI:35472) |
| cortisol (CHEBI:17650) has role drug allergen (CHEBI:88188) |
| cortisol (CHEBI:17650) has role human metabolite (CHEBI:77746) |
| cortisol (CHEBI:17650) has role mouse metabolite (CHEBI:75771) |
| cortisol (CHEBI:17650) is a 11β-hydroxy steroid (CHEBI:35346) |
| cortisol (CHEBI:17650) is a 17α-hydroxy-C21-steroid (CHEBI:138141) |
| cortisol (CHEBI:17650) is a 20-oxo steroid (CHEBI:36885) |
| cortisol (CHEBI:17650) is a 21-hydroxy steroid (CHEBI:35344) |
| cortisol (CHEBI:17650) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| cortisol (CHEBI:17650) is a glucocorticoid (CHEBI:24261) |
| cortisol (CHEBI:17650) is a primary α-hydroxy ketone (CHEBI:139590) |
| cortisol (CHEBI:17650) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| Incoming Relation(s) |
| 18-hydroxycortisol (CHEBI:89455) has functional parent cortisol (CHEBI:17650) |
| 18-oxocortisol (CHEBI:89213) has functional parent cortisol (CHEBI:17650) |
| 20β-dihydrocortisol (CHEBI:139311) has functional parent cortisol (CHEBI:17650) |
| 6β-hydroxycortisol (CHEBI:139271) has functional parent cortisol (CHEBI:17650) |
| cortisol ester (CHEBI:23396) has functional parent cortisol (CHEBI:17650) |
| deoxycortisol (CHEBI:23618) has functional parent cortisol (CHEBI:17650) |
| hydrocortisone caproate (CHEBI:31676) has functional parent cortisol (CHEBI:17650) |
| hydrocortisone succinate (CHEBI:31677) has functional parent cortisol (CHEBI:17650) |
| IUPAC Name |
|---|
| 11β,17,21-trihydroxypregn-4-ene-3,20-dione |
| INNs | Source |
|---|---|
| hidrocortisona | ChemIDplus |
| hydrocortisone | ChemIDplus |
| hydrocortisonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 11beta,17alpha,21-Trihydroxy-4-pregnene-3,20-dione | KEGG COMPOUND |
| (11β)-11,17,21-trihydroxypregn-4-ene-3,20-dione | NIST Chemistry WebBook |
| 11β,17α,21-trihydroxy-4-pregnene-3,20-dione | NIST Chemistry WebBook |
| 11β-hydrocortisone | NIST Chemistry WebBook |
| 17-hydroxycorticosterone | ChemIDplus |
| 4-pregnen-11β,17α,21-triol-3,20-dione | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| cortisol | UniProt |
| Citations |
|---|