EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O6 |
| Net Charge | 0 |
| Average Mass | 378.465 |
| Monoisotopic Mass | 378.20424 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])C[C@@H](O)C2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H30O6/c1-19-5-3-11(23)7-14(19)15(24)8-12-13-4-6-21(27,17(26)10-22)20(13,2)9-16(25)18(12)19/h7,12-13,15-16,18,22,24-25,27H,3-6,8-10H2,1-2H3/t12-,13-,15+,16-,18+,19-,20-,21-/m0/s1 |
| InChIKey | GNFTWPCIRXSCQF-UJXAPRPESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (19959402) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| Application: | probe A role played by a molecular entity used to study the microscopic environment. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6β-hydroxycortisol (CHEBI:139271) has functional parent cortisol (CHEBI:17650) |
| 6β-hydroxycortisol (CHEBI:139271) has role human metabolite (CHEBI:77746) |
| 6β-hydroxycortisol (CHEBI:139271) has role mammalian metabolite (CHEBI:75768) |
| 6β-hydroxycortisol (CHEBI:139271) has role probe (CHEBI:50406) |
| 6β-hydroxycortisol (CHEBI:139271) is a 11β-hydroxy steroid (CHEBI:35346) |
| 6β-hydroxycortisol (CHEBI:139271) is a 17α-hydroxy steroid (CHEBI:35342) |
| 6β-hydroxycortisol (CHEBI:139271) is a 20-oxo steroid (CHEBI:36885) |
| 6β-hydroxycortisol (CHEBI:139271) is a 21-hydroxy steroid (CHEBI:35344) |
| 6β-hydroxycortisol (CHEBI:139271) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 6β-hydroxycortisol (CHEBI:139271) is a 6β-hydroxy steroid (CHEBI:36851) |
| 6β-hydroxycortisol (CHEBI:139271) is a C21-steroid (CHEBI:61313) |
| 6β-hydroxycortisol (CHEBI:139271) is a primary α-hydroxy ketone (CHEBI:139590) |
| 6β-hydroxycortisol (CHEBI:139271) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 6β,11β,17,21-tetrahydroxypregn-4-ene-3,20-dione |
| Synonyms | Source |
|---|---|
| 6β,11β,17α,21-tetrahydroxypregn-4-ene-3,20-dione | SUBMITTER |
| (6β,11β)-6,11,17,21-tetrahydroxypregn-4-ene-3,20-dione | ChEBI |
| 6β-HO-cortisol | ChEBI |
| 6β-OH-cortisol | ChEBI |
| NSC 76163 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 6β-hydroxycortisol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2512454 | Reaxys |
| CAS:53-35-0 | ChemIDplus |
| Citations |
|---|