EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O6 |
| Net Charge | 0 |
| Average Mass | 460.611 |
| Monoisotopic Mass | 460.28249 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COC(=O)CCCCC)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C27H40O6/c1-4-5-6-7-23(31)33-16-22(30)27(32)13-11-20-19-9-8-17-14-18(28)10-12-25(17,2)24(19)21(29)15-26(20,27)3/h14,19-21,24,29,32H,4-13,15-16H2,1-3H3/t19-,20-,21-,24+,25-,26-,27-/m0/s1 |
| InChIKey | XZSVYVIYKBHVMV-FOMYWIRZSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydrocortisone caproate (CHEBI:31676) has functional parent cortisol (CHEBI:17650) |
| hydrocortisone caproate (CHEBI:31676) has parent hydride pregnane (CHEBI:8386) |
| hydrocortisone caproate (CHEBI:31676) is a 11β-hydroxy steroid (CHEBI:35346) |
| hydrocortisone caproate (CHEBI:31676) is a 17α-hydroxy steroid (CHEBI:35342) |
| hydrocortisone caproate (CHEBI:31676) is a 20-oxo steroid (CHEBI:36885) |
| hydrocortisone caproate (CHEBI:31676) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| hydrocortisone caproate (CHEBI:31676) is a cortisol ester (CHEBI:23396) |
| hydrocortisone caproate (CHEBI:31676) is a glucocorticoid (CHEBI:24261) |
| hydrocortisone caproate (CHEBI:31676) is a hexanoate ester (CHEBI:87656) |
| hydrocortisone caproate (CHEBI:31676) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 11β,17-dihydroxy-3,20-dioxopregn-4-en-21-yl hexanoate |
| Synonyms | Source |
|---|---|
| Hydrocortisone caproate | KEGG COMPOUND |
| [2-(11,17-Dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-2-oxo-ethyl]hexanoate | KEGG COMPOUND |
| 11beta,17,21-Trihydroxypregn-4-ene-3,20-dione 21-hexanoate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C13422 | KEGG COMPOUND |
| LMST02030129 | LIPID MAPS |
| D09796 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3020664 | Beilstein |
| CAS:3593-96-2 | KEGG COMPOUND |
| CAS:3593-96-2 | ChemIDplus |