EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O6 |
| Net Charge | 0 |
| Average Mass | 376.449 |
| Monoisotopic Mass | 376.18859 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C=O)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H28O6/c1-19-6-4-13(24)8-12(19)2-3-14-15-5-7-21(27,17(26)10-22)20(15,11-23)9-16(25)18(14)19/h8,11,14-16,18,22,25,27H,2-7,9-10H2,1H3/t14-,15-,16-,18+,19-,20+,21-/m0/s1 |
| InChIKey | XUQWWIFROYJHCU-UKSDXMLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood (UBERON:0000178) | PubMed (8038908) | ||
| Urine (NCIT:C13283) | PubMed (2539538) |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-oxocortisol (CHEBI:89213) has functional parent cortisol (CHEBI:17650) |
| 18-oxocortisol (CHEBI:89213) has parent hydride pregnane (CHEBI:8386) |
| 18-oxocortisol (CHEBI:89213) has role human urinary metabolite (CHEBI:84087) |
| 18-oxocortisol (CHEBI:89213) is a 11β-hydroxy steroid (CHEBI:35346) |
| 18-oxocortisol (CHEBI:89213) is a 17α-hydroxy-C21-steroid (CHEBI:138141) |
| 18-oxocortisol (CHEBI:89213) is a 20-oxo steroid (CHEBI:36885) |
| 18-oxocortisol (CHEBI:89213) is a 21-hydroxy steroid (CHEBI:35344) |
| 18-oxocortisol (CHEBI:89213) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 18-oxocortisol (CHEBI:89213) is a glucocorticoid (CHEBI:24261) |
| 18-oxocortisol (CHEBI:89213) is a mineralocorticoid (CHEBI:25354) |
| 18-oxocortisol (CHEBI:89213) is a primary α-hydroxy ketone (CHEBI:139590) |
| 18-oxocortisol (CHEBI:89213) is a steroid aldehyde (CHEBI:131565) |
| 18-oxocortisol (CHEBI:89213) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 11β,17,21-trihydroxy-3,20-dioxopregn-4-en-18-al |
| Synonyms | Source |
|---|---|
| (11β)-11,17,21-trihydroxy-3,20-dioxopregn-4-en-18-al | ChEBI |
| (11β,17α)-11,17,18,21-tetrahydroxypregn-4-ene-3,20-dione-18-al | ChEBI |
| 4-pregnene-11β,17α,21-triol-3,20-dione-18-al | LIPID MAPS |
| 18-oxo-cortisol | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| 18-oxocortisol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000332 | HMDB |
| FDB021957 | FooDB |
| LMST02030296 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:2410-60-8 | ChEMBL |
| Citations |
|---|