EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18 |
| Net Charge | 0 |
| Average Mass | 138.254 |
| Monoisotopic Mass | 138.14085 |
| SMILES | C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2 |
| InChIKey | NNBZCPXTIHJBJL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. |
| Application: | solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decalin (CHEBI:38853) has role solvent (CHEBI:46787) |
| decalin (CHEBI:38853) is a ortho-fused bicyclic hydrocarbon (CHEBI:35428) |
| Incoming Relation(s) |
| perfluorodecalin (CHEBI:38848) has parent hydride decalin (CHEBI:38853) |
| cis-decalin (CHEBI:38860) is a decalin (CHEBI:38853) |
| trans-decalin (CHEBI:38863) is a decalin (CHEBI:38853) |
| IUPAC Name |
|---|
| decahydronaphthalene |
| Synonyms | Source |
|---|---|
| bicyclo[4.4.0]decane | NIST Chemistry WebBook |
| decalin | ChemIDplus |
| Dekalin | ChemIDplus |
| Decahydronaphthalin | ChEBI |
| Dekahydronaphthalin | ChEBI |
| naphthane | NIST Chemistry WebBook |
| Citations |
|---|