EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38848 - perfluorodecalin
| Formula | C10F18 |
| Net Charge | 0 |
| Average Mass | 462.074 |
| Monoisotopic Mass | 461.97126 |
| SMILES | FC1(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C1(F)F |
| InChI | InChI=1S/C10F18/c11-1-2(12,5(17,18)9(25,26)7(21,22)3(1,13)14)6(19,20)10(27,28)8(23,24)4(1,15)16 |
| InChIKey | UWEYRJFJVCLAGH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. |
| Applications: | solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. blood substitute A substance that can carry oxygen to and carbon dioxide away from the tissues when introduced into the blood stream. Blood substitutes are used to replace hemoglobin in severe hemorrhage and also to perfuse isolated organs. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorodecalin (CHEBI:38848) has parent hydride decalin (CHEBI:38853) |
| perfluorodecalin (CHEBI:38848) has role blood substitute (CHEBI:38849) |
| perfluorodecalin (CHEBI:38848) has role solvent (CHEBI:46787) |
| perfluorodecalin (CHEBI:38848) is a fluorocarbon (CHEBI:38824) |
| IUPAC Name |
|---|
| octadecafluorodecahydronaphthalene |
| Synonyms | Source |
|---|---|
| Perflunafene | ChemIDplus |
| perfluorodecalin | ChemIDplus |
| 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecafluorodecahydronaphthalene | NIST Chemistry WebBook |
| octadecafluorodecaline | NIST Chemistry WebBook |
| decahydrooctadecafluoronaphthalene | ChemIDplus |
| FDC | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Perfluorodecalin | Wikipedia |
| 2103 | DrugCentral |
| Citations |
|---|