EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18 |
| Net Charge | 0 |
| Average Mass | 138.254 |
| Monoisotopic Mass | 138.14085 |
| SMILES | [H][C@]12CCCC[C@@]1([H])CCCC2 |
| InChI | InChI=1S/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
| InChIKey | NNBZCPXTIHJBJL-AOOOYVTPSA-N |
| Roles Classification |
|---|
| Chemical Role: | solvent A substance that dissolves other substances (solutes) to form a solution without any change in their chemical composition. |
| Application: | solvent A substance that dissolves other substances (solutes) to form a solution without any change in their chemical composition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-decalin (CHEBI:38860) is a decalin (CHEBI:38853) |
| IUPAC Names |
|---|
| (4as,8as)-decahydronaphthalene |
| cis-decahydronaphthalene |
| Synonyms | Source |
|---|---|
| cis-bicyclo[4.4.0]decane | NIST Chemistry WebBook |
| c-decahydronaphthalene | NIST Chemistry WebBook |
| c-decalin | NIST Chemistry WebBook |
| cis-decalin | ChemIDplus |
| cis-perhydronaphthalene | ChemIDplus |