EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18 |
| Net Charge | 0 |
| Average Mass | 138.254 |
| Monoisotopic Mass | 138.14085 |
| SMILES | [H][C@]12CCCC[C@]1([H])CCCC2 |
| InChI | InChI=1S/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10- |
| InChIKey | NNBZCPXTIHJBJL-MGCOHNPYSA-N |
| Roles Classification |
|---|
| Chemical Role: | solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. |
| Application: | solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-decalin (CHEBI:38863) is a decalin (CHEBI:38853) |
| Incoming Relation(s) |
| geosmin (CHEBI:46703) has parent hydride trans-decalin (CHEBI:38863) |
| IUPAC Names |
|---|
| (4ar,8ar)-decahydronaphthalene |
| trans-decahydronaphthalene |
| Synonyms | Source |
|---|---|
| trans-bicyclo[4.4.0]decane | NIST Chemistry WebBook |
| t-decalin | NIST Chemistry WebBook |
| trans-perhydronaphthalene | ChemIDplus |
| Citations |
|---|