EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28FN3O6S |
| Net Charge | 0 |
| Average Mass | 481.546 |
| Monoisotopic Mass | 481.16828 |
| SMILES | CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C22H28FN3O6S/c1-13(2)20-18(10-9-16(27)11-17(28)12-19(29)30)21(14-5-7-15(23)8-6-14)25-22(24-20)26(3)33(4,31)32/h5-10,13,16-17,27-28H,11-12H2,1-4H3,(H,29,30)/b10-9+/t16-,17-/m1/s1 |
| InChIKey | BPRHUIZQVSMCRT-VEUZHWNKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. CETP inhibitor Any inhibitor of cholesterylester transfer protein (CETP), which transfers cholesterol from high density lipoproteins (HDL, the 'good' cholesterol-containing particles) to low or very low density lipoproteins (LDL or VLDL, the 'bad' cholesterol-containing particles). Inhibition of this process results in higher HDL levels and lower LDL levels. CETP inhibitors are under investigation as potential drugs to reduce the risk of arteriosclerotic vascular disease (atherosclerosis). EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. cardioprotective agent Any protective agent that is able to prevent damage to the heart. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rosuvastatin (CHEBI:38545) has functional parent hept-6-enoic acid (CHEBI:38363) |
| rosuvastatin (CHEBI:38545) has role anti-inflammatory agent (CHEBI:67079) |
| rosuvastatin (CHEBI:38545) has role antilipemic drug (CHEBI:35679) |
| rosuvastatin (CHEBI:38545) has role cardioprotective agent (CHEBI:77307) |
| rosuvastatin (CHEBI:38545) has role CETP inhibitor (CHEBI:49205) |
| rosuvastatin (CHEBI:38545) has role environmental contaminant (CHEBI:78298) |
| rosuvastatin (CHEBI:38545) has role xenobiotic (CHEBI:35703) |
| rosuvastatin (CHEBI:38545) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| rosuvastatin (CHEBI:38545) is a monofluorobenzenes (CHEBI:83575) |
| rosuvastatin (CHEBI:38545) is a pyrimidines (CHEBI:39447) |
| rosuvastatin (CHEBI:38545) is a statin (synthetic) (CHEBI:87635) |
| rosuvastatin (CHEBI:38545) is a sulfonamide (CHEBI:35358) |
| rosuvastatin (CHEBI:38545) is conjugate acid of rosuvastatin(1−) (CHEBI:77313) |
| Incoming Relation(s) |
| rosuvastatin(1−) (CHEBI:77313) is conjugate base of rosuvastatin (CHEBI:38545) |
| IUPAC Name |
|---|
| (3R,5S,6E)-7-{4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-(propan-2-yl)pyrimidin-5-yl}-3,5-dihydroxyhept-6-enoic acid |
| INN | Source |
|---|---|
| rosuvastatin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (3R,5S,6E)-7-(4-(4-fluorophenyl)-6-(1-methylethyl)-2-(ethyl(methylsulfonyl)amino)-5-pyrimidinyl)-3,5-dihydroxy-6-heptenoic acid | ChemIDplus |
| (3R,5S,6E)-7-{4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]pyrimidin-5-yl}-3,5-dihydroxyhept-6-enoic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 2406 | DrugCentral |
| D08492 | KEGG DRUG |
| DB01098 | DrugBank |
| HMDB0015230 | HMDB |
| Rosuvastatin | Wikipedia |
| US2013035316 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9670765 | Reaxys |
| CAS:287714-41-4 | ChemIDplus |
| Citations |
|---|