EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2 |
| Net Charge | 0 |
| Average Mass | 212.296 |
| Monoisotopic Mass | 212.13135 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)[C@@]1([H])CCCN2 |
| InChI | InChI=1S/C14H16N2/c1-3-11-10-4-2-6-15-13(10)7-9-8-16-12(5-1)14(9)11/h1,3,5,8,10,13,15-16H,2,4,6-7H2/t10-,13-/m1/s1 |
| InChIKey | RHGUXDUPXYFCTE-ZWNOBZJWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergoline (CHEBI:38484) is a diamine (CHEBI:23666) |
| ergoline (CHEBI:38484) is a ergoline alkaloid (CHEBI:60529) |
| ergoline (CHEBI:38484) is a indole alkaloid (CHEBI:38958) |
| ergoline (CHEBI:38484) is a indole alkaloid fundamental parent (CHEBI:38482) |
| ergoline (CHEBI:38484) is a organic heterotetracyclic compound (CHEBI:38163) |
| Incoming Relation(s) |
| O-(cyclohexanecarbonyl)lysergol (CHEBI:60527) has parent hydride ergoline (CHEBI:38484) |
| 6-methylergoline (CHEBI:2215) has parent hydride ergoline (CHEBI:38484) |
| 6,8-dimethyl-6,7-didehydroergolin-6-ium (CHEBI:65034) has parent hydride ergoline (CHEBI:38484) |
| 9-deacetoxyfumigaclavine C (CHEBI:65724) has parent hydride ergoline (CHEBI:38484) |
| didehydroagroclavine (CHEBI:65036) has parent hydride ergoline (CHEBI:38484) |
| ergometrine (CHEBI:4822) has parent hydride ergoline (CHEBI:38484) |
| festuclavine (CHEBI:65035) has parent hydride ergoline (CHEBI:38484) |
| fumigaclavine A (CHEBI:67159) has parent hydride ergoline (CHEBI:38484) |
| fumigaclavine B (CHEBI:67156) has parent hydride ergoline (CHEBI:38484) |
| fumigaclavine C (CHEBI:64673) has parent hydride ergoline (CHEBI:38484) |
| lisuride (CHEBI:51164) has parent hydride ergoline (CHEBI:38484) |
| lysergamide (CHEBI:4819) has parent hydride ergoline (CHEBI:38484) |
| mesulergine (CHEBI:73378) has parent hydride ergoline (CHEBI:38484) |
| methysergide (CHEBI:584020) has parent hydride ergoline (CHEBI:38484) |
| IUPAC Name |
|---|
| ergoline |
| Synonyms | Source |
|---|---|
| (2R,7R)-6,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene | IUPAC |
| (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline | IUPAC |
| (6aR-trans)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline | ChEBI |
| ergoline I | ChemIDplus |
| Citations |
|---|