EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:584020 - methysergide
| Formula | C21H27N3O2 |
| Net Charge | 0 |
| Average Mass | 353.466 |
| Monoisotopic Mass | 353.21033 |
| SMILES | [H][C@@]12Cc3cn(C)c4cccc(c34)C1=C[C@@H](C(=O)NC(CC)CO)CN2C |
| InChI | InChI=1S/C21H27N3O2/c1-4-15(12-25)22-21(26)14-8-17-16-6-5-7-18-20(16)13(10-23(18)2)9-19(17)24(3)11-14/h5-8,10,14-15,19,25H,4,9,11-12H2,1-3H3,(H,22,26)/t14-,15?,19-/m1/s1 |
| InChIKey | KPJZHOPZRAFDTN-NQUBZZJWSA-N |
| Roles Classification |
|---|
| Biological Roles: | sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). vasoconstrictor agent Drug used to cause constriction of the blood vessels. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methysergide (CHEBI:584020) has parent hydride ergoline (CHEBI:38484) |
| methysergide (CHEBI:584020) has role serotonergic antagonist (CHEBI:48279) |
| methysergide (CHEBI:584020) has role sympatholytic agent (CHEBI:66991) |
| methysergide (CHEBI:584020) has role vasoconstrictor agent (CHEBI:50514) |
| methysergide (CHEBI:584020) is a ergot alkaloid (CHEBI:23943) |
| methysergide (CHEBI:584020) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| (8R)-N-[1-hydroxymethyl(propyl)]-1,6-dimethyl-9,10-didehydroergoline-8-carboxamide |
| INNs | Source |
|---|---|
| methysergide | ChEBI |
| méthysergide | ChEBI |
| methysergidum | ChEBI |
| metisergida | ChEBI |
| Synonyms | Source |
|---|---|
| Methysergide | KEGG COMPOUND |
| (+)-9,10-Didehydro-N-(1-(hydroxymethyl)propyl)-1,6-dimethylergoline-8β-carboxamide | ChemIDplus |
| (+)-N-(1-(Hydroxymethyl)propyl)-1-methyl-D-lysergamide | ChemIDplus |
| 1-Methyl-D-lysergic acid butanolamide | ChemIDplus |
| 1-Methyl-dextro-lysergic acid (+)-1-hydroxy-2-butylamide | ChemIDplus |
| 1-Methyllysergic acid butanolamide | ChemIDplus |