EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:584020 - methysergide
| Formula | C21H27N3O2 |
| Net Charge | 0 |
| Average Mass | 353.466 |
| Monoisotopic Mass | 353.21033 |
| SMILES | [H][C@@]12Cc3cn(C)c4cccc(c34)C1=C[C@@H](C(=O)NC(CC)CO)CN2C |
| InChI | InChI=1S/C21H27N3O2/c1-4-15(12-25)22-21(26)14-8-17-16-6-5-7-18-20(16)13(10-23(18)2)9-19(17)24(3)11-14/h5-8,10,14-15,19,25H,4,9,11-12H2,1-3H3,(H,22,26)/t14-,15?,19-/m1/s1 |
| InChIKey | KPJZHOPZRAFDTN-NQUBZZJWSA-N |
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | vasoconstrictor agent Drug used to cause constriction of the blood vessels. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methysergide (CHEBI:584020) has parent hydride ergoline (CHEBI:38484) |
| methysergide (CHEBI:584020) has role serotonergic antagonist (CHEBI:48279) |
| methysergide (CHEBI:584020) has role sympatholytic agent (CHEBI:66991) |
| methysergide (CHEBI:584020) has role vasoconstrictor agent (CHEBI:50514) |
| methysergide (CHEBI:584020) is a ergot alkaloid (CHEBI:23943) |
| methysergide (CHEBI:584020) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| (8R)-N-[1-hydroxymethyl(propyl)]-1,6-dimethyl-9,10-didehydroergoline-8-carboxamide |
| INNs | Source |
|---|---|
| methysergide | ChEBI |
| méthysergide | ChEBI |
| methysergidum | ChEBI |
| metisergida | ChEBI |
| Synonyms | Source |
|---|---|
| 1-Methyl-dextro-lysergic acid (+)-1-hydroxy-2-butylamide | ChemIDplus |
| 1-Methyllysergic acid butanolamide | ChemIDplus |
| 1-Methylmethylergonovine | ChemIDplus |
| 1-Methyl-D-lysergic acid butanolamide | ChemIDplus |
| 9,10-Didehydro-N-(1-(hydroxymethyl)propyl)-1,6-dimethylergoline-8-carboxamide | ChemIDplus |
| (+)-9,10-Didehydro-N-(1-(hydroxymethyl)propyl)-1,6-dimethylergoline-8β-carboxamide | ChemIDplus |