EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N2 |
| Net Charge | 0 |
| Average Mass | 226.323 |
| Monoisotopic Mass | 226.14700 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)[C@@]1([H])CCCN2C |
| InChI | InChI=1S/C15H18N2/c1-17-7-3-5-11-12-4-2-6-13-15(12)10(9-16-13)8-14(11)17/h2,4,6,9,11,14,16H,3,5,7-8H2,1H3/t11-,14-/m1/s1 |
| InChIKey | NNDATQSUZGLGQT-BXUZGUMPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methylergoline (CHEBI:2215) has parent hydride ergoline (CHEBI:38484) |
| 6-methylergoline (CHEBI:2215) is a ergoline alkaloid (CHEBI:60529) |
| Incoming Relation(s) |
| lysergic acid (CHEBI:6604) has parent hydride 6-methylergoline (CHEBI:2215) |
| IUPAC Name |
|---|
| 6-methylergoline |
| Synonyms | Source |
|---|---|
| (−)-(5R,10R)-6-methylergoline | ChEBI |
| 6-Methylergoline | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07540 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4255779 | Reaxys |
| Beilstein:4461333 | Beilstein |
| CAS:109922-46-5 | KEGG COMPOUND |
| Citations |
|---|