EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O3 |
| Net Charge | 0 |
| Average Mass | 128.127 |
| Monoisotopic Mass | 128.04734 |
| SMILES | [H]C(C)=CCC(=O)C(=O)O |
| InChI | InChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h2-3H,4H2,1H3,(H,8,9) |
| InChIKey | XGNKMQBCAVIQOR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxohex-4-enoic acid (CHEBI:38353) has functional parent hex-4-enoic acid (CHEBI:38355) |
| 2-oxohex-4-enoic acid (CHEBI:38353) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-oxohex-4-enoic acid (CHEBI:38353) is conjugate acid of 2-oxohex-4-enoate (CHEBI:38351) |
| Incoming Relation(s) |
| cis-2-oxohex-4-enoic acid (CHEBI:38352) is a 2-oxohex-4-enoic acid (CHEBI:38353) |
| trans-2-oxohex-4-enoic acid (CHEBI:28998) is a 2-oxohex-4-enoic acid (CHEBI:38353) |
| 2-oxohex-4-enoate (CHEBI:38351) is conjugate base of 2-oxohex-4-enoic acid (CHEBI:38353) |
| IUPAC Name |
|---|
| 2-oxohex-4-enoic acid |
| Synonym | Source |
|---|---|
| 2-oxo-4-hexenoic acid | ChEBI |