EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O2 |
| Net Charge | 0 |
| Average Mass | 114.144 |
| Monoisotopic Mass | 114.06808 |
| SMILES | [H]C(C)=CCCC(=O)O |
| InChI | InChI=1S/C6H10O2/c1-2-3-4-5-6(7)8/h2-3H,4-5H2,1H3,(H,7,8) |
| InChIKey | NIDHFQDUBOVBKZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hex-4-enoic acid (CHEBI:38355) is a hexenoic acid (CHEBI:24580) |
| Incoming Relation(s) |
| 2-oxohex-4-enoic acid (CHEBI:38353) has functional parent hex-4-enoic acid (CHEBI:38355) |
| mycophenolic acid (CHEBI:168396) has functional parent hex-4-enoic acid (CHEBI:38355) |
| cis-hex-4-enoic acid (CHEBI:38357) is a hex-4-enoic acid (CHEBI:38355) |
| trans-hex-4-enoic acid (CHEBI:38356) is a hex-4-enoic acid (CHEBI:38355) |
| IUPAC Name |
|---|
| hex-4-enoic acid |
| Synonyms | Source |
|---|---|
| 4-hexenoic acid | LIPID MAPS |
| 4-hexenoic acids | ChEBI |
| hex-4-enoic acids | ChEBI |
| γ-hexenoic acid | LIPID MAPS |
| γ-hexenoic acids | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030010 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1720995 | Beilstein |