EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7O3 |
| Net Charge | -1 |
| Average Mass | 127.119 |
| Monoisotopic Mass | 127.04007 |
| SMILES | [H]C(C)=CCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h2-3H,4H2,1H3,(H,8,9)/p-1 |
| InChIKey | XGNKMQBCAVIQOR-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxohex-4-enoate (CHEBI:38351) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| 2-oxohex-4-enoate (CHEBI:38351) is conjugate base of 2-oxohex-4-enoic acid (CHEBI:38353) |
| Incoming Relation(s) |
| cis-2-oxohex-4-enoate (CHEBI:38354) is a 2-oxohex-4-enoate (CHEBI:38351) |
| trans-2-oxohex-4-enoate (CHEBI:19751) is a 2-oxohex-4-enoate (CHEBI:38351) |
| 2-oxohex-4-enoic acid (CHEBI:38353) is conjugate acid of 2-oxohex-4-enoate (CHEBI:38351) |
| IUPAC Name |
|---|
| 2-oxohex-4-enoate |
| Synonym | Source |
|---|---|
| 2-oxo-4-hexenoate | ChEBI |