EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O3 |
| Net Charge | 0 |
| Average Mass | 128.127 |
| Monoisotopic Mass | 128.04734 |
| SMILES | C/C=C\CC(=O)C(=O)O |
| InChI | InChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h2-3H,4H2,1H3,(H,8,9)/b3-2- |
| InChIKey | XGNKMQBCAVIQOR-IHWYPQMZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-2-oxohex-4-enoic acid (CHEBI:38352) has functional parent cis-hex-4-enoic acid (CHEBI:38357) |
| cis-2-oxohex-4-enoic acid (CHEBI:38352) is a 2-oxohex-4-enoic acid (CHEBI:38353) |
| cis-2-oxohex-4-enoic acid (CHEBI:38352) is conjugate acid of cis-2-oxohex-4-enoate (CHEBI:38354) |
| Incoming Relation(s) |
| cis-2-oxohex-4-enoate (CHEBI:38354) is conjugate base of cis-2-oxohex-4-enoic acid (CHEBI:38352) |
| IUPAC Name |
|---|
| (4Z)-2-oxohex-4-enoic acid |
| Synonym | Source |
|---|---|
| (Z)-2-oxo-4-hexenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2075122 | Beilstein |