EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C52H97N16O13R |
| Average Mass (excl. R groups) | 1154.428 |
| Monoisotopic Mass (excl. R groups) | 1153.74210 |
| SMILES | *C[C@@H](C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CCN)NC1=O)[C@@H](C)O |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colistin (CHEBI:37943) has part colistin A (CHEBI:59064) |
| colistin (CHEBI:37943) has part colistin B (CHEBI:59673) |
| colistin (CHEBI:37943) has role nephrotoxic agent (CHEBI:50909) |
| colistin (CHEBI:37943) is a peptide antibiotic (CHEBI:25903) |
| colistin (CHEBI:37943) is a polymyxin (CHEBI:59062) |
| Incoming Relation(s) |
| colistimethate (CHEBI:59662) has functional parent colistin (CHEBI:37943) |
| colistimethate sodium (CHEBI:34650) has functional parent colistin (CHEBI:37943) |
| INNs | Source |
|---|---|
| colistina | ChemIDplus |
| colistine | ChemIDplus |
| colistinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Colistin | ChEMBL |
| polymyxin E | ChemIDplus |
| Citations |
|---|