EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C53H100N16O13 |
| Net Charge | 0 |
| Average Mass | 1169.482 |
| Monoisotopic Mass | 1168.76558 |
| SMILES | CC[C@@H](C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CCN)NC1=O)[C@@H](C)O |
| InChI | InChI=1S/C53H100N16O13/c1-9-30(6)12-10-11-13-41(72)60-33(14-20-54)48(77)69-43(32(8)71)53(82)65-36(17-23-57)45(74)64-38-19-25-59-52(81)42(31(7)70)68-49(78)37(18-24-58)62-44(73)34(15-21-55)63-50(79)39(26-28(2)3)67-51(80)40(27-29(4)5)66-46(75)35(16-22-56)61-47(38)76/h28-40,42-43,70-71H,9-27,54-58H2,1-8H3,(H,59,81)(H,60,72)(H,61,76)(H,62,73)(H,63,79)(H,64,74)(H,65,82)(H,66,75)(H,67,80)(H,68,78)(H,69,77)/t30-,31-,32-,33+,34+,35+,36+,37+,38+,39+,40-,42+,43+/m1/s1 |
| InChIKey | XDJYMJULXQKGMM-RVYUQJQSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colistin A (CHEBI:59064) is a peptide antibiotic (CHEBI:25903) |
| colistin A (CHEBI:59064) is a polymyxin (CHEBI:59062) |
| Incoming Relation(s) |
| colistimethate A (CHEBI:59669) has functional parent colistin A (CHEBI:59064) |
| colistin A sodium methanesulfonate (CHEBI:59663) has functional parent colistin A (CHEBI:59064) |
| colistin (CHEBI:37943) has part colistin A (CHEBI:59064) |
| IUPAC Name |
|---|
| 4,10-anhydro{N-[(6R)-6-methyloctanoyl]-L-2,4-diaminobutanoyl-L-threonyl-L-2,4-diaminobutanoyl-L-2,4-diaminobutanoyl-L-2,4-diaminobutanoyl-D-leucyl-L-leucyl-L-2,4-diaminobutanoyl-L-2,4-diaminobutanoyl-L-threonine} |
| Synonyms | Source |
|---|---|
| Colistin A | ChemIDplus |
| Colistin IV | ChemIDplus |
| Polymixin E1 | ChemIDplus |
| Polymyxin E1 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8609559 | Reaxys |
| CAS:7722-44-3 | ChemIDplus |
| Citations |
|---|