EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O6 |
| Net Charge | 0 |
| Average Mass | 342.347 |
| Monoisotopic Mass | 342.11034 |
| SMILES | C=C(c1c(OC)cc(O)c2c(=O)c3ccc(O)c(O)c3oc12)C(C)C |
| InChI | InChI=1S/C19H18O6/c1-8(2)9(3)14-13(24-4)7-12(21)15-16(22)10-5-6-11(20)17(23)18(10)25-19(14)15/h5-8,20-21,23H,3H2,1-2,4H3 |
| InChIKey | NSYLWTGDDXBREV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia vieillardii (IPNI:428302-1) | stem (BTO:0001300) | PubMed (15104511) | Previous component: stem bark; |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vieillardixanthone (CHEBI:66367) has functional parent xanthone (CHEBI:37647) |
| vieillardixanthone (CHEBI:66367) has role antioxidant (CHEBI:22586) |
| vieillardixanthone (CHEBI:66367) has role metabolite (CHEBI:25212) |
| vieillardixanthone (CHEBI:66367) is a aromatic ether (CHEBI:35618) |
| vieillardixanthone (CHEBI:66367) is a phenols (CHEBI:33853) |
| vieillardixanthone (CHEBI:66367) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,5,6-trihydroxy-3-methoxy-4-(3-methylbut-1-en-2-yl)-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11309215 | Reaxys |
| Citations |
|---|