EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O11 |
| Net Charge | 0 |
| Average Mass | 422.342 |
| Monoisotopic Mass | 422.08491 |
| SMILES | [H][C@@]1(c2c(O)cc3oc4cc(O)c(O)cc4c(=O)c3c2O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H18O11/c20-4-11-15(25)17(27)18(28)19(30-11)12-8(23)3-10-13(16(12)26)14(24)5-1-6(21)7(22)2-9(5)29-10/h1-3,11,15,17-23,25-28H,4H2/t11-,15-,17+,18-,19+/m1/s1 |
| InChIKey | AEDDIBAIWPIIBD-ZJKJAXBQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Canscora decussata (IPNI:366549-1) | - | PubMed (807707) | |
| Cratoxylum cochinchinense (ncbitaxon:271749) | - | PubMed (15182859) | |
| Cratoxylum pruniflorum (IPNI:433071-1) | - | Article (PHARMAZINE, 1988, 43, 879) | |
| Cyclopia genistoides (ncbitaxon:70073) | - | DOI (10.1007/s00217-002-0644-5) | |
| Cyclopia intermedia (ncbitaxon:384038) | - | DOI (10.1007/s00217-002-0644-5) | |
| Cyclopia maculata (ncbitaxon:155107) | - | DOI (10.1007/s00217-002-0644-5) | |
| Cyclopia sessiliflora (ncbitaxon:337842) | - | DOI (10.1007/s00217-002-0644-5) | |
| Cyclopia subternata (ncbitaxon:155109) | - | PubMed (15315375) | |
| Gentiana cruciata (ncbitaxon:49943) | - | DOI (10.1016/S0031-9422(00)88887-1) | |
| Gentiana lutea (ncbitaxon:38851) | - | PubMed (10705751) | |
| Gentianella campestris (ncbitaxon:49940) | - | DOI (10.1002/hlca.19750580731) | |
| Gentianopsis (ncbitaxon:50798) | - | DOI (10.1016/0305-1978(82)90006-0) | |
| Hypericum perforatum (ncbitaxon:65561) | - | DOI (10.1078/0176-1617-00195) | |
| Hypericum sampsonii (ncbitaxon:282553) | - | DOI (10.1016/j.phytochem.2004.08.014) | |
| Mangifera indica (ncbitaxon:29780) | - | DOI (10.1246/bcsj.30.618) | |
| Salacia chinensis (ncbitaxon:1009589) | - | PubMed (12951446) | |
| Salacia reticulata (IPNI:162694-1) | - | DOI (10.1248/yakushi.121.371) | |
| Swertia chirata (IPNI:60447539-2) | - | DOI (10.1016/S0040-4039(00)95355-3) | |
| Swertia cordata (ncbitaxon:148628) | - | DOI (10.1021/np50103a019) | |
| Swertia corymbosa (IPNI:370853-1) | - | PubMed (11978432) | |
| Swertia franchetiana (ncbitaxon:50785) | - | DOI (10.1016/j.bse.2004.02.008) | |
| Swertia punctata (IPNI:371052-1) | - | PubMed (12377236) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mangiferin (CHEBI:6682) has functional parent xanthone (CHEBI:37647) |
| mangiferin (CHEBI:6682) has role anti-inflammatory agent (CHEBI:67079) |
| mangiferin (CHEBI:6682) has role antioxidant (CHEBI:22586) |
| mangiferin (CHEBI:6682) has role hypoglycemic agent (CHEBI:35526) |
| mangiferin (CHEBI:6682) has role plant metabolite (CHEBI:76924) |
| mangiferin (CHEBI:6682) is a C-glycosyl compound (CHEBI:20857) |
| mangiferin (CHEBI:6682) is a xanthones (CHEBI:51149) |
| mangiferin (CHEBI:6682) is conjugate acid of mangiferin(1−) (CHEBI:194216) |
| Incoming Relation(s) |
| mangiferin(1−) (CHEBI:194216) is conjugate base of mangiferin (CHEBI:6682) |
| IUPAC Name |
|---|
| 2-β-D-glucopyranosyl-1,3,6,7-tetrahydroxy-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| (1S)-1,5-anhydro-1-(1,3,6,7-tetrahydroxy-9-oxo-9H-xanthen-2-yl)-D-glucitol | ChEBI |
| Alpizarin | ChemIDplus |
| Aphloiol | ChemIDplus |
| Chinomin | KEGG COMPOUND |
| Chinomin | ChemIDplus |
| Chinonin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00002962 | KNApSAcK |
| C10077 | KEGG COMPOUND |
| Mangiferin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:65853 | Reaxys |
| CAS:4773-96-0 | ChemIDplus |
| CAS:4773-96-0 | KEGG COMPOUND |
| Citations |
|---|