EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O7 |
| Net Charge | 0 |
| Average Mass | 196.155 |
| Monoisotopic Mass | 196.05830 |
| SMILES | O=C(O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A1221h]/1/ |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3+,4+,5-/m0/s1 |
| InChIKey | RGHNJXZEOKUKBD-RSJOWCBRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-galactonic acid (CHEBI:37425) has role Escherichia coli metabolite (CHEBI:76971) |
| L-galactonic acid (CHEBI:37425) is a galactonic acid (CHEBI:24149) |
| L-galactonic acid (CHEBI:37425) is conjugate acid of L-galactonate (CHEBI:53071) |
| L-galactonic acid (CHEBI:37425) is enantiomer of D-galactonic acid (CHEBI:16534) |
| Incoming Relation(s) |
| L-galactono-1,4-lactone (CHEBI:17464) has functional parent L-galactonic acid (CHEBI:37425) |
| 3,6-anhydro-L-galactonic acid (CHEBI:84257) has functional parent L-galactonic acid (CHEBI:37425) |
| L-galactonate (CHEBI:53071) is conjugate base of L-galactonic acid (CHEBI:37425) |
| D-galactonic acid (CHEBI:16534) is enantiomer of L-galactonic acid (CHEBI:37425) |
| IUPAC Name |
|---|
| L-galactonic acid |
| Manual Xrefs | Databases |
|---|---|
| US2008176300 | Patent |
| WO2004029264 | Patent |
| EP1543133 | Patent |
| US2006166339 | Patent |
| C15930 | KEGG COMPOUND |
| 2Q2 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726062 | Reaxys |
| Citations |
|---|