EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O6 |
| Net Charge | 0 |
| Average Mass | 178.140 |
| Monoisotopic Mass | 178.04774 |
| SMILES | [H][C@@]1([C@H](O)C(=O)O)OC[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[A1221h_3-6]/1/ |
| InChI | InChI=1S/C6H10O6/c7-2-1-12-5(3(2)8)4(9)6(10)11/h2-5,7-9H,1H2,(H,10,11)/t2-,3+,4-,5+/m0/s1 |
| InChIKey | ZDDQAAZBPZGPRB-SKNVOMKLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,6-anhydro-L-galactonic acid (CHEBI:84257) has functional parent L-galactonic acid (CHEBI:37425) |
| 3,6-anhydro-L-galactonic acid (CHEBI:84257) has role marine metabolite (CHEBI:76507) |
| 3,6-anhydro-L-galactonic acid (CHEBI:84257) is a anhydrohexose (CHEBI:22557) |
| 3,6-anhydro-L-galactonic acid (CHEBI:84257) is a carbohydrate acid (CHEBI:33720) |
| IUPAC Name |
|---|
| 3,6-anhydro-L-galactonic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-17129 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1426018 | Reaxys |
| Citations |
|---|