EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16534 - D-galactonic acid
| Formula | C6H12O7 |
| Net Charge | 0 |
| Average Mass | 196.155 |
| Monoisotopic Mass | 196.05830 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A2112h]/1/ |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3+,4+,5-/m1/s1 |
| InChIKey | RGHNJXZEOKUKBD-MGCNEYSASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-galactonic acid (CHEBI:16534) is a galactonic acid (CHEBI:24149) |
| D-galactonic acid (CHEBI:16534) is conjugate acid of D-galactonate (CHEBI:12931) |
| D-galactonic acid (CHEBI:16534) is enantiomer of L-galactonic acid (CHEBI:37425) |
| Incoming Relation(s) |
| N-acetyl-D-galactosaminic acid (CHEBI:38440) has functional parent D-galactonic acid (CHEBI:16534) |
| D-galactono-1,4-lactone (CHEBI:15895) has functional parent D-galactonic acid (CHEBI:16534) |
| D-galactono-1,5-lactone (CHEBI:15945) has functional parent D-galactonic acid (CHEBI:16534) |
| 6-phospho-2-dehydro-3-deoxy-D-galactonic acid (CHEBI:17860) has functional parent D-galactonic acid (CHEBI:16534) |
| D-galactonate (CHEBI:12931) is conjugate base of D-galactonic acid (CHEBI:16534) |
| L-galactonic acid (CHEBI:37425) is enantiomer of D-galactonic acid (CHEBI:16534) |
| IUPAC Name |
|---|
| D-galactonic acid |
| Synonym | Source |
|---|---|
| D-Galactonic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00880 | KEGG COMPOUND |
| HMDB0000565 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726059 | Reaxys |
| CAS:576-36-3 | ChemIDplus |