EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O7 |
| Net Charge | -1 |
| Average Mass | 195.147 |
| Monoisotopic Mass | 195.05103 |
| SMILES | O=C([O-])[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/p-1/t2-,3+,4+,5-/m0/s1 |
| InChIKey | RGHNJXZEOKUKBD-RSJOWCBRSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-galactonate (CHEBI:53071) has role human metabolite (CHEBI:77746) |
| L-galactonate (CHEBI:53071) is a galactonate (CHEBI:24148) |
| L-galactonate (CHEBI:53071) is conjugate base of L-galactonic acid (CHEBI:37425) |
| L-galactonate (CHEBI:53071) is enantiomer of D-galactonate (CHEBI:12931) |
| Incoming Relation(s) |
| 3,6-anhydro-L-galactonate (CHEBI:83435) has functional parent L-galactonate (CHEBI:53071) |
| L-galactonic acid (CHEBI:37425) is conjugate acid of L-galactonate (CHEBI:53071) |
| D-galactonate (CHEBI:12931) is enantiomer of L-galactonate (CHEBI:53071) |
| IUPAC Name |
|---|
| L-galactonate |
| UniProt Name | Source |
|---|---|
| L-galactonate | UniProt |
| Citations |
|---|