EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:37316 - (E,E)-piperic acid
| Formula | C12H10O4 |
| Net Charge | 0 |
| Average Mass | 218.208 |
| Monoisotopic Mass | 218.05791 |
| SMILES | O=C(O)/C=C/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H10O4/c13-12(14)4-2-1-3-9-5-6-10-11(7-9)16-8-15-10/h1-7H,8H2,(H,13,14)/b3-1+,4-2+ |
| InChIKey | RHBGITBPARBDPH-ZPUQHVIOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E,E)-piperic acid (CHEBI:37316) has functional parent (E)-penta-2,4-dienoic acid (CHEBI:37331) |
| (E,E)-piperic acid (CHEBI:37316) has role plant metabolite (CHEBI:76924) |
| (E,E)-piperic acid (CHEBI:37316) is a benzodioxoles (CHEBI:38298) |
| (E,E)-piperic acid (CHEBI:37316) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (E,E)-piperic acid (CHEBI:37316) is conjugate acid of (E,E)-piperate (CHEBI:192831) |
| Incoming Relation(s) |
| (E,E)-piperonyl-CoA (CHEBI:15464) has functional parent (E,E)-piperic acid (CHEBI:37316) |
| piperine (CHEBI:28821) has functional parent (E,E)-piperic acid (CHEBI:37316) |
| piperyline (CHEBI:9691) has functional parent (E,E)-piperic acid (CHEBI:37316) |
| (E,E)-piperate (CHEBI:192831) is conjugate base of (E,E)-piperic acid (CHEBI:37316) |
| IUPAC Name |
|---|
| (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid |
| Synonyms | Source |
|---|---|
| Piperic acid (E,E)-form | ChemIDplus |
| trans,trans-piperinic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Piperic_acid | Wikipedia |
| HMDB0033779 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:85624 | Reaxys |
| CAS:136-72-1 | ChemIDplus |
| Citations |
|---|