EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO3 |
| Net Charge | 0 |
| Average Mass | 271.316 |
| Monoisotopic Mass | 271.12084 |
| SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)N1CCCC1 |
| InChI | InChI=1S/C16H17NO3/c18-16(17-9-3-4-10-17)6-2-1-5-13-7-8-14-15(11-13)20-12-19-14/h1-2,5-8,11H,3-4,9-10,12H2/b5-1+,6-2+ |
| InChIKey | GQIJYUMTOUBHSH-IJIVKGSJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper arboreum (ncbitaxon:130381) | leaf (BTO:0000713) | DOI (10.5897/AJB09.182) | |
| Piper guineense (ncbitaxon:511543) | |||
| fruit (BTO:0000486) | PubMed (1271969) | ||
| leaf (BTO:0000713) | PubMed (30423994) | ||
| Piper macropodum (ncbitaxon:2045273) | stem (BTO:0001300) | PubMed (2618672) | |
| Piper nigrum (ncbitaxon:13216) | - | PubMed (30073789) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperyline (CHEBI:9691) has functional parent (E,E)-piperic acid (CHEBI:37316) |
| piperyline (CHEBI:9691) has role antifungal agent (CHEBI:35718) |
| piperyline (CHEBI:9691) has role apoptosis inducer (CHEBI:68495) |
| piperyline (CHEBI:9691) has role plant metabolite (CHEBI:76924) |
| piperyline (CHEBI:9691) is a N-acylpyrrolidine (CHEBI:46766) |
| piperyline (CHEBI:9691) is a benzodioxoles (CHEBI:38298) |
| piperyline (CHEBI:9691) is a pyrrolidine alkaloid (CHEBI:26456) |
| piperyline (CHEBI:9691) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-(pyrrolidin-1-yl)penta-2,4-dien-1-one |
| Synonyms | Source |
|---|---|
| 1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-oxo-2,4-pentadienyl]pyrrolidine | ChEBI |
| (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-(1-pyrrolidinyl)-2,4-pentadien-1-one | ChEBI |
| (2E,4E)-5-(2H-1,3-benzodioxol-5-yl)-1-(pyrrolidin-1-yl)penta-2,4-dien-1-one | IUPAC |
| piperiline | ChemIDplus |
| piperylin | ChemIDplus |
| pyrroperine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| piperyline | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 552302 | ChemSpider |
| C00002076 | KNApSAcK |
| C10174 | KEGG COMPOUND |
| FDB000444 | FooDB |
| HMDB0029374 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29164 | Reaxys |
| CAS:25924-78-1 | NIST Chemistry WebBook |
| CAS:25924-78-1 | ChemIDplus |
| Citations |
|---|