EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO3 |
| Net Charge | 0 |
| Average Mass | 271.316 |
| Monoisotopic Mass | 271.12084 |
| SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)N1CCCC1 |
| InChI | InChI=1S/C16H17NO3/c18-16(17-9-3-4-10-17)6-2-1-5-13-7-8-14-15(11-13)20-12-19-14/h1-2,5-8,11H,3-4,9-10,12H2/b5-1+,6-2+ |
| InChIKey | GQIJYUMTOUBHSH-IJIVKGSJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper nigrum (ncbitaxon:13216) | - | PubMed (30073789) | |
| Piper arboreum (ncbitaxon:130381) | leaf (BTO:0000713) | DOI (10.5897/AJB09.182) | |
| Piper guineense (ncbitaxon:511543) | |||
| fruit (BTO:0000486) | PubMed (1271969) | ||
| leaf (BTO:0000713) | PubMed (30423994) | ||
| Piper macropodum (ncbitaxon:2045273) | stem (BTO:0001300) | PubMed (2618672) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperyline (CHEBI:9691) has functional parent (E,E)-piperic acid (CHEBI:37316) |
| piperyline (CHEBI:9691) has role antifungal agent (CHEBI:35718) |
| piperyline (CHEBI:9691) has role apoptosis inducer (CHEBI:68495) |
| piperyline (CHEBI:9691) has role plant metabolite (CHEBI:76924) |
| piperyline (CHEBI:9691) is a N-acylpyrrolidine (CHEBI:46766) |
| piperyline (CHEBI:9691) is a benzodioxoles (CHEBI:38298) |
| piperyline (CHEBI:9691) is a pyrrolidine alkaloid (CHEBI:26456) |
| piperyline (CHEBI:9691) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-(pyrrolidin-1-yl)penta-2,4-dien-1-one |
| Synonyms | Source |
|---|---|
| trichostachine | ChemIDplus |
| (2E,4E)-5-(2H-1,3-benzodioxol-5-yl)-1-(pyrrolidin-1-yl)penta-2,4-dien-1-one | IUPAC |
| piperiline | ChemIDplus |
| piperylin | ChemIDplus |
| pyrroperine | ChemIDplus |
| trichostachin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| piperyline | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C10174 | KEGG COMPOUND |
| C00002076 | KNApSAcK |
| HMDB0029374 | HMDB |
| FDB000444 | FooDB |
| 552302 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29164 | Reaxys |
| CAS:25924-78-1 | ChemIDplus |
| CAS:25924-78-1 | NIST Chemistry WebBook |
| Citations |
|---|