EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28821 - piperine
| Formula | C17H19NO3 |
| Net Charge | 0 |
| Average Mass | 285.343 |
| Monoisotopic Mass | 285.13649 |
| SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3+ |
| InChIKey | MXXWOMGUGJBKIW-YPCIICBESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) | |
| Piper betle (ncbitaxon:13217) | - | DOI (10.1016/S0031-9422(98)00208-8) | |
| Piper khasianum (ncbitaxon:405331) | - | DOI (10.1016/S0031-9422(98)00208-8) | |
| Piper nigrum (ncbitaxon:13216) | - | PubMed (10575373) |
| Roles Classification |
|---|
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperine (CHEBI:28821) has functional parent (E,E)-piperic acid (CHEBI:37316) |
| piperine (CHEBI:28821) has role food component (CHEBI:78295) |
| piperine (CHEBI:28821) has role human blood serum metabolite (CHEBI:85234) |
| piperine (CHEBI:28821) has role NF-κB inhibitor (CHEBI:73240) |
| piperine (CHEBI:28821) has role plant metabolite (CHEBI:76924) |
| piperine (CHEBI:28821) is a N-acylpiperidine (CHEBI:48591) |
| piperine (CHEBI:28821) is a benzodioxoles (CHEBI:38298) |
| piperine (CHEBI:28821) is a piperidine alkaloid (CHEBI:26147) |
| piperine (CHEBI:28821) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoyl]piperidine |
| Synonyms | Source |
|---|---|
| 1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-oxo-2,4-pentadienyl]piperidine | ChemIDplus |
| 1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)-2,4-pentadienoyl]piperidine | NIST Chemistry WebBook |
| 1-piperoylpiperidine | NIST Chemistry WebBook |
| 1-Piperoyl-piperidine | KEGG COMPOUND |
| (E,E)-1-piperoylpiperidine | ChemIDplus |
| N-[(E,E)-Piperoyl]piperidine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| piperine | UniProt |
| Citations |
|---|