EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:36969 - farnesoic acid
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(=O)O |
| InChI | InChI=1S/C15H24O2/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17/h7,9,11H,5-6,8,10H2,1-4H3,(H,16,17) |
| InChIKey | WJHFZYAELPOJIV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| farnesoic acid (CHEBI:36969) has functional parent dodeca-2,6,10-trienoic acid (CHEBI:36972) |
| farnesoic acid (CHEBI:36969) has role signalling molecule (CHEBI:62488) |
| farnesoic acid (CHEBI:36969) is a methyl-branched fatty acid (CHEBI:62499) |
| farnesoic acid (CHEBI:36969) is a trienoic fatty acid (CHEBI:73155) |
| farnesoic acid (CHEBI:36969) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| farnesoyl-CoA (CHEBI:28562) has functional parent farnesoic acid (CHEBI:36969) |
| methyl farnesoate (CHEBI:80535) has functional parent farnesoic acid (CHEBI:36969) |
| (2E,6E)-farnesoic acid (CHEBI:84162) is a farnesoic acid (CHEBI:36969) |
| IUPAC Name |
|---|
| 3,7,11-trimethyldodeca-2,6,10-trienoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1785779 | Reaxys |
| CAS:7548-13-2 | ChemIDplus |
| Citations |
|---|