EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:80535 - methyl farnesoate
| Formula | C16H26O2 |
| Net Charge | 0 |
| Average Mass | 250.382 |
| Monoisotopic Mass | 250.19328 |
| SMILES | COC(=O)/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H26O2/c1-13(2)8-6-9-14(3)10-7-11-15(4)12-16(17)18-5/h8,10,12H,6-7,9,11H2,1-5H3/b14-10+,15-12+ |
| InChIKey | NWKXNIPBVLQYAB-VDQVFBMKSA-N |
| Roles Classification |
|---|
| Biological Roles: | crustacean metabolite An animal metabolite produced by arthropods such as crabs, lobsters, crayfish, shrimps and krill. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl farnesoate (CHEBI:80535) has functional parent farnesoic acid (CHEBI:36969) |
| methyl farnesoate (CHEBI:80535) has role crustacean metabolite (CHEBI:83039) |
| methyl farnesoate (CHEBI:80535) is a enoate ester (CHEBI:51702) |
| methyl farnesoate (CHEBI:80535) is a fatty acid methyl ester (CHEBI:4986) |
| methyl farnesoate (CHEBI:80535) is a juvenile hormone (CHEBI:24943) |
| Incoming Relation(s) |
| juvenile hormone III bisepoxide (CHEBI:83642) has functional parent methyl farnesoate (CHEBI:80535) |
| juvenile hormone III skipped bisepoxide (CHEBI:83643) has functional parent methyl farnesoate (CHEBI:80535) |
| IUPAC Name |
|---|
| methyl (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
| Synonyms | Source |
|---|---|
| methyl (2E,6E)-farnesoate | MetaCyc |
| (2E,6E)-farnesyl methyl ester | MetaCyc |
| methyl (2-trans,6-trans)-farnesoate | MetaCyc |
| methyl (E,E)-farnesate | NIST Chemistry WebBook |
| Methyl farnesate | NIST Chemistry WebBook |
| Methyl 3,7,11-trimethyl-2,6,10-dodecatrienoate | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| methyl (2E,6E)-farnesoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726950 | Reaxys |
| CAS:10485-70-8 | KEGG COMPOUND |
| CAS:10485-70-8 | ChemIDplus |
| CAS:10485-70-8 | NIST Chemistry WebBook |
| Citations |
|---|