EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:84162 - (2E,6E)-farnesoic acid
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(=O)O |
| InChI | InChI=1S/C15H24O2/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17/h7,9,11H,5-6,8,10H2,1-4H3,(H,16,17)/b13-9+,14-11+ |
| InChIKey | WJHFZYAELPOJIV-IJFRVEDASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,6E)-farnesoic acid (CHEBI:84162) has role animal metabolite (CHEBI:75767) |
| (2E,6E)-farnesoic acid (CHEBI:84162) is a farnesoic acid (CHEBI:36969) |
| (2E,6E)-farnesoic acid (CHEBI:84162) is conjugate acid of (2E,6E)-farnesoate (CHEBI:83276) |
| Incoming Relation(s) |
| (2E,6E)-farnesoate (CHEBI:83276) is conjugate base of (2E,6E)-farnesoic acid (CHEBI:84162) |
| IUPAC Name |
|---|
| (2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrienoic acid |
| Synonyms | Source |
|---|---|
| Farnesoic acid | KEGG COMPOUND |
| trans,trans-Farnesoic acid | KEGG COMPOUND |
| all-trans-farnesoic acid | MetaCyc |
| (2E,6E)-farnesylic acid | MetaCyc |
| (2E,6E)-farnesic acid | MetaCyc |
| (2-trans-6-trans) farnesoic acid | MetaCyc |
| Citations |
|---|