EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21FN2O |
| Net Charge | 0 |
| Average Mass | 324.399 |
| Monoisotopic Mass | 324.16379 |
| SMILES | CN(C)CCC[C@]1(c2ccc(F)cc2)OCc2cc(C#N)ccc21 |
| InChI | InChI=1S/C20H21FN2O/c1-23(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24-20/h4-9,12H,3,10-11,14H2,1-2H3/t20-/m1/s1 |
| InChIKey | WSEQXVZVJXJVFP-HXUWFJFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-citalopram (CHEBI:36792) is a 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile (CHEBI:77397) |
| (R)-citalopram (CHEBI:36792) is conjugate base of (R)-citalopram(1+) (CHEBI:77405) |
| (R)-citalopram (CHEBI:36792) is enantiomer of escitalopram (CHEBI:36791) |
| Incoming Relation(s) |
| citalopram (CHEBI:3723) has part (R)-citalopram (CHEBI:36792) |
| (R)-citalopram(1+) (CHEBI:77405) is conjugate acid of (R)-citalopram (CHEBI:36792) |
| escitalopram (CHEBI:36791) is enantiomer of (R)-citalopram (CHEBI:36792) |
| Synonyms | Source |
|---|---|
| (1R)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile | ChEBI |
| (−)-citalopram | ChEBI |
| (R)-(−)-citalopram | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9001443 | Reaxys |
| Citations |
|---|