EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22FN2O |
| Net Charge | +1 |
| Average Mass | 325.407 |
| Monoisotopic Mass | 325.17107 |
| SMILES | C[NH+](C)CCC[C@]1(c2ccc(F)cc2)OCc2cc(C#N)ccc21 |
| InChI | InChI=1S/C20H21FN2O/c1-23(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24-20/h4-9,12H,3,10-11,14H2,1-2H3/p+1/t20-/m1/s1 |
| InChIKey | WSEQXVZVJXJVFP-HXUWFJFHSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-citalopram(1+) (CHEBI:77405) is a 3-[5-cyano-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-1-yl]-N,N-dimethylpropan-1-aminium (CHEBI:77408) |
| (R)-citalopram(1+) (CHEBI:77405) is conjugate acid of (R)-citalopram (CHEBI:36792) |
| (R)-citalopram(1+) (CHEBI:77405) is enantiomer of escitalopram(1+) (CHEBI:77406) |
| Incoming Relation(s) |
| citalopram(1+) (CHEBI:77407) has part (R)-citalopram(1+) (CHEBI:77405) |
| (R)-citalopram (CHEBI:36792) is conjugate base of (R)-citalopram(1+) (CHEBI:77405) |
| escitalopram(1+) (CHEBI:77406) is enantiomer of (R)-citalopram(1+) (CHEBI:77405) |
| IUPAC Name |
|---|
| 3-[(1R)-5-cyano-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-1-yl]-N,N-dimethylpropan-1-aminium |