EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21FN2O |
| Net Charge | 0 |
| Average Mass | 324.399 |
| Monoisotopic Mass | 324.16379 |
| SMILES | CN(C)CCC[C@@]1(c2ccc(F)cc2)OCc2cc(C#N)ccc21 |
| InChI | InChI=1S/C20H21FN2O/c1-23(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24-20/h4-9,12H,3,10-11,14H2,1-2H3/t20-/m0/s1 |
| InChIKey | WSEQXVZVJXJVFP-FQEVSTJZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (14708881) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| escitalopram (CHEBI:36791) has role antidepressant (CHEBI:35469) |
| escitalopram (CHEBI:36791) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| escitalopram (CHEBI:36791) is a 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile (CHEBI:77397) |
| escitalopram (CHEBI:36791) is conjugate base of escitalopram(1+) (CHEBI:77406) |
| escitalopram (CHEBI:36791) is enantiomer of (R)-citalopram (CHEBI:36792) |
| Incoming Relation(s) |
| citalopram (CHEBI:3723) has part escitalopram (CHEBI:36791) |
| escitalopram(1+) (CHEBI:77406) is conjugate acid of escitalopram (CHEBI:36791) |
| (R)-citalopram (CHEBI:36792) is enantiomer of escitalopram (CHEBI:36791) |
| IUPAC Name |
|---|
| (1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile |
| INNs | Source |
|---|---|
| escitalopramum | WHO MedNet |
| escitalopram | WHO MedNet |
| escitalopram | WHO MedNet |
| escitalopram | WHO MedNet |
| Synonyms | Source |
|---|---|
| (S)-citalopram | ChemIDplus |
| S(+)-citalopram | ChemIDplus |
| S-(+)-citalopram | ChEBI |
| (+)-citalopram | ChEBI |
| Brand Name | Source |
|---|---|
| Esertia | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| Escitalopram | Wikipedia |
| DB01175 | DrugBank |
| D07913 | KEGG DRUG |
| HMDB0005028 | HMDB |
| LSM-3569 | LINCS |
| 1053 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9001444 | Beilstein |
| CAS:128196-01-0 | ChemIDplus |
| Citations |
|---|