EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21FN2O |
| Net Charge | 0 |
| Average Mass | 324.399 |
| Monoisotopic Mass | 324.16379 |
| SMILES | CN(C)CCC[C@@]1(c2ccc(F)cc2)OCc2cc(C#N)ccc21 |
| InChI | InChI=1S/C20H21FN2O/c1-23(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24-20/h4-9,12H,3,10-11,14H2,1-2H3/t20-/m0/s1 |
| InChIKey | WSEQXVZVJXJVFP-FQEVSTJZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (14708881) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). |
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| escitalopram (CHEBI:36791) has role antidepressant (CHEBI:35469) |
| escitalopram (CHEBI:36791) has role antihypertensive agent (CHEBI:35674) |
| escitalopram (CHEBI:36791) has role antineoplastic agent (CHEBI:35610) |
| escitalopram (CHEBI:36791) has role antipsychotic agent (CHEBI:35476) |
| escitalopram (CHEBI:36791) has role antirheumatic drug (CHEBI:35842) |
| escitalopram (CHEBI:36791) has role antiviral agent (CHEBI:22587) |
| escitalopram (CHEBI:36791) has role anxiolytic drug (CHEBI:35474) |
| escitalopram (CHEBI:36791) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| escitalopram (CHEBI:36791) is a 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile (CHEBI:77397) |
| escitalopram (CHEBI:36791) is conjugate base of escitalopram(1+) (CHEBI:77406) |
| escitalopram (CHEBI:36791) is enantiomer of (R)-citalopram (CHEBI:36792) |
| Incoming Relation(s) |
| citalopram (CHEBI:3723) has part escitalopram (CHEBI:36791) |
| escitalopram(1+) (CHEBI:77406) is conjugate acid of escitalopram (CHEBI:36791) |
| (R)-citalopram (CHEBI:36792) is enantiomer of escitalopram (CHEBI:36791) |
| IUPAC Name |
|---|
| (1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile |
| INNs | Source |
|---|---|
| escitalopram | WHO MedNet |
| escitalopram | WHO MedNet |
| escitalopram | WHO MedNet |
| escitalopramum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (+)-citalopram | ChEBI |
| Esitol | ChEMBL |
| (S)-citalopram | ChemIDplus |
| S(+)-citalopram | ChemIDplus |
| S-(+)-citalopram | ChEBI |
| LU-26-054 | ChEMBL |
| Brand Name | Source |
|---|---|
| Esertia | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1053 | DrugCentral |
| D07913 | KEGG DRUG |
| DB01175 | DrugBank |
| Escitalopram | Wikipedia |
| HMDB0005028 | HMDB |
| LSM-3569 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9001444 | Beilstein |
| CAS:128196-01-0 | ChemIDplus |
| Citations |
|---|