EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87185 - florfenicol
| Formula | C12H14Cl2FNO4S |
| Net Charge | 0 |
| Average Mass | 358.218 |
| Monoisotopic Mass | 357.00046 |
| SMILES | CS(=O)(=O)c1ccc([C@@H](O)[C@@H](CF)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C12H14Cl2FNO4S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-15)16-12(18)11(13)14/h2-5,9-11,17H,6H2,1H3,(H,16,18)/t9-,10-/m1/s1 |
| InChIKey | AYIRNRDRBQJXIF-NXEZZACHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| florfenicol (CHEBI:87185) has functional parent dichloroacetic acid (CHEBI:36386) |
| florfenicol (CHEBI:87185) has role antimicrobial agent (CHEBI:33281) |
| florfenicol (CHEBI:87185) is a organochlorine compound (CHEBI:36683) |
| florfenicol (CHEBI:87185) is a organofluorine compound (CHEBI:37143) |
| florfenicol (CHEBI:87185) is a secondary alcohol (CHEBI:35681) |
| florfenicol (CHEBI:87185) is a secondary carboxamide (CHEBI:140325) |
| florfenicol (CHEBI:87185) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 2,2-dichloro-N-{(1R,2S)-3-fluoro-1-hydroxy-1-[4-(methanesulfonyl)phenyl]propan-2-yl}acetamide |
| INN | Source |
|---|---|
| florfenicol | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (-)-Florfenicol | ChemIDplus |
| D-threo-2,2-Dichloro-N-(alpha-(fluoromethyl)-beta-hydroxy-p-(methylsulfonyl)phenethyl)acetamide | ChemIDplus |
| Sch-25298 | ChemIDplus |
| Sch 25298 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Nuflor | KEGG DRUG |
| Nuflor gold | ChemIDplus |
| Citations |
|---|