EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28240 - dichloroacetate
| Formula | C2HCl2O2 |
| Net Charge | -1 |
| Average Mass | 127.934 |
| Monoisotopic Mass | 126.93591 |
| SMILES | O=C([O-])C(Cl)Cl |
| InChI | InChI=1S/C2H2Cl2O2/c3-1(4)2(5)6/h1H,(H,5,6)/p-1 |
| InChIKey | JXTHNDFMNIQAHM-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dichloroacetate (CHEBI:28240) has functional parent acetate (CHEBI:30089) |
| dichloroacetate (CHEBI:28240) has role geroprotector (CHEBI:176497) |
| dichloroacetate (CHEBI:28240) is a monocarboxylic acid anion (CHEBI:35757) |
| dichloroacetate (CHEBI:28240) is conjugate base of dichloroacetic acid (CHEBI:36386) |
| Incoming Relation(s) |
| dichloroacetic acid (CHEBI:36386) is conjugate acid of dichloroacetate (CHEBI:28240) |
| IUPAC Name |
|---|
| dichloroacetate |
| Synonyms | Source |
|---|---|
| dichloracetate | ChemIDplus |
| dichloroacetate ion | ChemIDplus |
| dichloroacetic acid ion(1−) | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Gmelin:200685 | Gmelin |
| Reaxys:3903873 | Reaxys |
| CAS:13425-80-4 | ChemIDplus |
| Citations |
|---|