EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2HCl3O |
| Net Charge | 0 |
| Average Mass | 147.388 |
| Monoisotopic Mass | 145.90930 |
| SMILES | O=C(Cl)C(Cl)Cl |
| InChI | InChI=1S/C2HCl3O/c3-1(4)2(5)6/h1H |
| InChIKey | FBCCMZVIWNDFMO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dichloroacetyl chloride (CHEBI:34688) has functional parent dichloroacetic acid (CHEBI:36386) |
| dichloroacetyl chloride (CHEBI:34688) has role hapten (CHEBI:59174) |
| dichloroacetyl chloride (CHEBI:34688) is a acyl chloride (CHEBI:36687) |
| IUPAC Name |
|---|
| dichloroacetyl chloride |
| Synonyms | Source |
|---|---|
| 2,2-Dichloroacetyl chloride | ChemIDplus |
| Chlorure de dichloracetyle | ChemIDplus |
| Dichloracetyl chloride | ChemIDplus |
| Dichloroethanoyl chloride | ChemIDplus |
| α,α-dichloroacetyl chloride | ChemIDplus |
| Dichloroacetic acid chloride | NIST Chemistry WebBook |
| Citations |
|---|