EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O5 |
| Net Charge | -2 |
| Average Mass | 146.098 |
| Monoisotopic Mass | 146.02262 |
| SMILES | CC(O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C5H8O5/c1-5(10,4(8)9)2-3(6)7/h10H,2H2,1H3,(H,6,7)(H,8,9)/p-2 |
| InChIKey | XFTRTWQBIOMVPK-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (6145530) | |
| Malus domestica (ncbitaxon:3750) | - | PubMed (13160012) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citramalate(2−) (CHEBI:13997) has functional parent butenedioate (CHEBI:36180) |
| citramalate(2−) (CHEBI:13997) has role human metabolite (CHEBI:77746) |
| citramalate(2−) (CHEBI:13997) has role plant metabolite (CHEBI:76924) |
| citramalate(2−) (CHEBI:13997) is a dicarboxylic acid dianion (CHEBI:28965) |
| citramalate(2−) (CHEBI:13997) is conjugate base of citramalic acid (CHEBI:15584) |
| Incoming Relation(s) |
| D-citramalate(2−) (CHEBI:30934) is a citramalate(2−) (CHEBI:13997) |
| L-citramalate(2−) (CHEBI:30936) is a citramalate(2−) (CHEBI:13997) |
| citramalic acid (CHEBI:15584) is conjugate acid of citramalate(2−) (CHEBI:13997) |
| IUPAC Name |
|---|
| 2-hydroxy-2-methylbutanedioate |
| Synonyms | Source |
|---|---|
| 2-hydroxy-2-methylsuccinate | ChEBI |
| 2-methylmalate | ChEBI |
| UniProt Name | Source |
|---|---|
| citramalate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3944359 | Reaxys |