EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40N2O6S |
| Net Charge | 0 |
| Average Mass | 496.670 |
| Monoisotopic Mass | 496.26071 |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](N)C(=O)NCC(=O)O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C25H40N2O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-22(21(28)15-14-17-23(29)30)34-19-20(26)25(33)27-18-24(31)32/h6-7,9-13,16,20-22,28H,2-5,8,14-15,17-19,26H2,1H3,(H,27,33)(H,29,30)(H,31,32)/b7-6-,10-9-,12-11+,16-13+/t20-,21-,22+/m0/s1 |
| InChIKey | YEESKJGWJFYOOK-IJHYULJSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | bronchoconstrictor agent A drug which causes a narrowing of the lumen of a bronchus or bronchiole. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leukotriene D4 (CHEBI:28666) has functional parent icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) |
| leukotriene D4 (CHEBI:28666) has role bronchoconstrictor agent (CHEBI:50141) |
| leukotriene D4 (CHEBI:28666) has role human metabolite (CHEBI:77746) |
| leukotriene D4 (CHEBI:28666) has role mouse metabolite (CHEBI:75771) |
| leukotriene D4 (CHEBI:28666) is a dipeptide (CHEBI:46761) |
| leukotriene D4 (CHEBI:28666) is a leukotriene (CHEBI:25029) |
| leukotriene D4 (CHEBI:28666) is a organic sulfide (CHEBI:16385) |
| leukotriene D4 (CHEBI:28666) is conjugate acid of leukotriene D4(1−) (CHEBI:63166) |
| Incoming Relation(s) |
| leukotriene D4(1−) (CHEBI:63166) is conjugate base of leukotriene D4 (CHEBI:28666) |
| IUPAC Name |
|---|
| S-{(1R,2E,4E,6Z,9Z)-1-[(1S)-4-carboxy-1-hydroxybutyl]pentadeca-2,4,6,9-tetraen-1-yl}-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| Leukotriene D4 | KEGG COMPOUND |
| LTD4 | KEGG COMPOUND |
| 5S-hydroxy-6R-(S-cysteinylglycinyl)-7E,9E,11E,14Z-eicosatetraenoic acid | LIPID MAPS |
| (R-(R*,S*-(E,E,Z,Z)))-N-(S-(1-(4-Carboxy-1-hydroxybutyl)-2,4,6,9-pentadecatetraenyl)-L-cysteinyl)glycine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05951 | KEGG COMPOUND |
| LMFA03020006 | LIPID MAPS |
| HMDB0003080 | HMDB |
| Leukotriene_D4 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4726738 | Reaxys |
| CAS:73836-78-9 | ChemIDplus |
| CAS:73836-78-9 | KEGG COMPOUND |
| Citations |
|---|