EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36O5S |
| Net Charge | 0 |
| Average Mass | 472.647 |
| Monoisotopic Mass | 472.22835 |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](Sc1ccc(C(=O)O)cc1)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C27H36O5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-25(24(28)15-14-17-26(29)30)33-23-20-18-22(19-21-23)27(31)32/h6-7,9-13,16,18-21,24-25,28H,2-5,8,14-15,17H2,1H3,(H,29,30)(H,31,32)/b7-6-,10-9-,12-11+,16-13+/t24-,25+/m0/s1 |
| InChIKey | PKJINWOACFYDQN-RBVMPENBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. |
| Application: | leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BAYu9773 (CHEBI:167654) has functional parent icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) |
| BAYu9773 (CHEBI:167654) has role leukotriene antagonist (CHEBI:49159) |
| BAYu9773 (CHEBI:167654) is a benzoic acids (CHEBI:22723) |
| BAYu9773 (CHEBI:167654) is a dicarboxylic acid (CHEBI:35692) |
| BAYu9773 (CHEBI:167654) is a organic sulfide (CHEBI:16385) |
| BAYu9773 (CHEBI:167654) is a polyunsaturated fatty acid (CHEBI:26208) |
| BAYu9773 (CHEBI:167654) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 4-{[(4S,5R,6E,8E,10Z,13Z)-1-carboxy-4-hydroxynonadeca-6,8,10,13-tetraen-5-yl]sulfanyl}benzoic acid |
| Synonyms | Source |
|---|---|
| 6(R)-(4-carboxyphenylthio)-5(S)-hydroxy-7(E),9(E),11(E),14(Z)-eicosatetraenoic acid | ChEBI |
| BAY u9773 | ChemIDplus |
| BAY-u 9773 | ChemIDplus |
| BAY-u9773 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4470554 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:154978-38-8 | ChemIDplus |
| Citations |
|---|