EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H34O2 |
| Net Charge | 0 |
| Average Mass | 294.479 |
| Monoisotopic Mass | 294.25588 |
| SMILES | CCCCCCCCC1=C(CCCCCCCC(=O)O)C1 |
| InChI | InChI=1S/C19H34O2/c1-2-3-4-5-7-10-13-17-16-18(17)14-11-8-6-9-12-15-19(20)21/h2-16H2,1H3,(H,20,21) |
| InChIKey | PQRKPYLNZGDCFH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sterculic acid (CHEBI:9261) has functional parent octadec-9-enoic acid (CHEBI:36021) |
| sterculic acid (CHEBI:9261) is a cyclopropenyl fatty acid (CHEBI:23501) |
| sterculic acid (CHEBI:9261) is a long-chain fatty acid (CHEBI:15904) |
| sterculic acid (CHEBI:9261) is a monounsaturated fatty acid (CHEBI:25413) |
| IUPAC Name |
|---|
| 8-(2-octylcycloprop-1-en-1-yl)octanoic acid |
| Synonyms | Source |
|---|---|
| 2-octyl-1-cyclopropene-1-octanoic acid | ChemIDplus |
| 8-(2-Octyl-cycloprop-1-enyl)-octansäure | ChEBI |
| 9,10-methylene-9-octadecenoic acid | LIPID MAPS |
| 9,10-Mt 9c-18:1 | ChEBI |
| Sterculia-Säure | ChEBI |
| Sterculic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001239 | KNApSAcK |
| C08366 | KEGG COMPOUND |
| LMFA01140018 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1880442 | Reaxys |
| CAS:738-87-4 | ChemIDplus |
| CAS:738-87-4 | KEGG COMPOUND |
| Citations |
|---|