EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O2 |
| Net Charge | 0 |
| Average Mass | 100.117 |
| Monoisotopic Mass | 100.05243 |
| SMILES | C=CCCC(=O)O |
| InChI | InChI=1S/C5H8O2/c1-2-3-4-5(6)7/h2H,1,3-4H2,(H,6,7) |
| InChIKey | HVAMZGADVCBITI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pent-4-enoic acid (CHEBI:35936) is a pentenoic acid (CHEBI:25897) |
| pent-4-enoic acid (CHEBI:35936) is conjugate acid of pent-4-enoate (CHEBI:35935) |
| Incoming Relation(s) |
| L-2-amino-4-chloropent-4-enoic acid (CHEBI:15885) has functional parent pent-4-enoic acid (CHEBI:35936) |
| 2-oxopent-4-enoic acid (CHEBI:37318) has functional parent pent-4-enoic acid (CHEBI:35936) |
| pent-4-enoate (CHEBI:35935) is conjugate base of pent-4-enoic acid (CHEBI:35936) |
| IUPAC Name |
|---|
| pent-4-enoic acid |
| Synonyms | Source |
|---|---|
| 4-pentenoic acid | ChemIDplus |
| allylacetic acid | ChemIDplus |
| Δ4-pentenoic acid | NIST Chemistry WebBook |
| allyl acetic acid | LIPID MAPS |
| 4-penten-1-oic acid | ChEBI |
| 3-vinylpropionic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030007 | LIPID MAPS |
| Citations |
|---|