EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8ClNO2 |
| Net Charge | 0 |
| Average Mass | 149.577 |
| Monoisotopic Mass | 149.02436 |
| SMILES | C=C(Cl)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H8ClNO2/c1-3(6)2-4(7)5(8)9/h4H,1-2,7H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | WLZNZXQYFWOBGU-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-2-amino-4-chloropent-4-enoic acid (CHEBI:15885) has functional parent pent-4-enoic acid (CHEBI:35936) |
| L-2-amino-4-chloropent-4-enoic acid (CHEBI:15885) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-2-amino-4-chloropent-4-enoic acid (CHEBI:15885) is a organochlorine compound (CHEBI:36683) |
| L-2-amino-4-chloropent-4-enoic acid (CHEBI:15885) is conjugate acid of L-2-amino-4-chloropent-4-enoate (CHEBI:32819) |
| L-2-amino-4-chloropent-4-enoic acid (CHEBI:15885) is tautomer of L-2-amino-4-chloropent-4-enoic acid zwitterion (CHEBI:57555) |
| Incoming Relation(s) |
| L-2-amino-4-chloropent-4-enoate (CHEBI:32819) is conjugate base of L-2-amino-4-chloropent-4-enoic acid (CHEBI:15885) |
| L-2-amino-4-chloropent-4-enoic acid zwitterion (CHEBI:57555) is tautomer of L-2-amino-4-chloropent-4-enoic acid (CHEBI:15885) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-chloropent-4-enoic acid |
| Synonyms | Source |
|---|---|
| 2-Amino-4-chloro-4-pentenoic acid | KEGG COMPOUND |
| (S)-2-amino-4-chloro-4-pentenoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3933203 | Beilstein |
| CAS:55528-30-8 | KEGG COMPOUND |
| CAS:55528-30-8 | ChemIDplus |