EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7O2 |
| Net Charge | -1 |
| Average Mass | 99.109 |
| Monoisotopic Mass | 99.04515 |
| SMILES | C=CCCC(=O)[O-] |
| InChI | InChI=1S/C5H8O2/c1-2-3-4-5(6)7/h2H,1,3-4H2,(H,6,7)/p-1 |
| InChIKey | HVAMZGADVCBITI-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pent-4-enoate (CHEBI:35935) is a pentenoate (CHEBI:36030) |
| pent-4-enoate (CHEBI:35935) is conjugate base of pent-4-enoic acid (CHEBI:35936) |
| Incoming Relation(s) |
| L-2-amino-4-chloropent-4-enoate (CHEBI:32819) has functional parent pent-4-enoate (CHEBI:35935) |
| 2-oxopent-4-enoate (CHEBI:11641) has functional parent pent-4-enoate (CHEBI:35935) |
| pent-4-enoic acid (CHEBI:35936) is conjugate acid of pent-4-enoate (CHEBI:35935) |
| IUPAC Name |
|---|
| pent-4-enoate |
| Synonyms | Source |
|---|---|
| 4-pentenoate | ChEBI |
| Allylacetat | ChEBI |
| allylacetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3536584 | Reaxys |
| Citations |
|---|