EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O2 |
| Net Charge | 0 |
| Average Mass | 86.090 |
| Monoisotopic Mass | 86.03678 |
| SMILES | C=CCC(=O)O |
| InChI | InChI=1S/C4H6O2/c1-2-3-4(5)6/h2H,1,3H2,(H,5,6) |
| InChIKey | PVEOYINWKBTPIZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| but-3-enoic acid (CHEBI:35897) is a butenoic acid (CHEBI:22959) |
| but-3-enoic acid (CHEBI:35897) is conjugate acid of but-3-enoate (CHEBI:35900) |
| Incoming Relation(s) |
| (3E)-4-(5-amino-2-hydroxyphenyl)-2-oxobut-3-enoic acid (CHEBI:18558) has functional parent but-3-enoic acid (CHEBI:35897) |
| N-vinylacetylglycine (CHEBI:74435) has functional parent but-3-enoic acid (CHEBI:35897) |
| cis-4-(1-hydroxy-2-naphthyl)-2-oxobut-3-enoic acid (CHEBI:29011) has functional parent but-3-enoic acid (CHEBI:35897) |
| 3-isopropylbut-3-enoic acid (CHEBI:20092) has functional parent but-3-enoic acid (CHEBI:35897) |
| 4-(2-carboxyphenyl)-2-oxobut-3-enoic acid (CHEBI:49223) has functional parent but-3-enoic acid (CHEBI:35897) |
| but-3-enoate (CHEBI:35900) is conjugate base of but-3-enoic acid (CHEBI:35897) |
| IUPAC Name |
|---|
| but-3-enoic acid |
| Synonyms | Source |
|---|---|
| 2-propenylcarboxylic acid | ChEBI |
| 3-buten-1-oic acid | ChEBI |
| 3-butenoic acid | ChemIDplus |
| 3-butenoic acid | ChEBI |
| allylic acid | ChEBI |
| ethenylacetic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030004 | LIPID MAPS |