EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO4 |
| Net Charge | 0 |
| Average Mass | 207.185 |
| Monoisotopic Mass | 207.05316 |
| SMILES | Nc1ccc(O)c(/C=C/C(=O)C(=O)O)c1 |
| InChI | InChI=1S/C10H9NO4/c11-7-2-4-8(12)6(5-7)1-3-9(13)10(14)15/h1-5,12H,11H2,(H,14,15)/b3-1+ |
| InChIKey | BZGJCDWVAPDSDE-HNQUOIGGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3E)-4-(5-amino-2-hydroxyphenyl)-2-oxobut-3-enoic acid (CHEBI:18558) has functional parent but-3-enoic acid (CHEBI:35897) |
| (3E)-4-(5-amino-2-hydroxyphenyl)-2-oxobut-3-enoic acid (CHEBI:18558) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| IUPAC Name |
|---|
| (3E)-4-(5-amino-2-hydroxyphenyl)-2-oxobut-3-enoic acid |
| Synonym | Source |
|---|---|
| (3E)-4-(5-Amino-2-hydroxy-phenyl)-2-oxo-but-3-ene-1-oic-acid | UM-BBD |
| Manual Xrefs | Databases |
|---|---|
| c0759 | UM-BBD |