EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O5 |
| Net Charge | 0 |
| Average Mass | 220.180 |
| Monoisotopic Mass | 220.03717 |
| SMILES | [H]C(=Cc1ccccc1C(=O)O)C(=O)C(=O)O |
| InChI | InChI=1S/C11H8O5/c12-9(11(15)16)6-5-7-3-1-2-4-8(7)10(13)14/h1-6H,(H,13,14)(H,15,16) |
| InChIKey | APKXMKWCGDBYNV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2-carboxyphenyl)-2-oxobut-3-enoic acid (CHEBI:49223) has functional parent benzoic acid (CHEBI:30746) |
| 4-(2-carboxyphenyl)-2-oxobut-3-enoic acid (CHEBI:49223) has functional parent but-3-enoic acid (CHEBI:35897) |
| 4-(2-carboxyphenyl)-2-oxobut-3-enoic acid (CHEBI:49223) is a oxo carboxylic acid (CHEBI:25754) |
| Incoming Relation(s) |
| (3Z)-4-(2-carboxyphenyl)-2-oxobut-3-enoic acid (CHEBI:49222) is a 4-(2-carboxyphenyl)-2-oxobut-3-enoic acid (CHEBI:49223) |
| trans-2-carboxybenzylidenepyruvic acid (CHEBI:15612) is a 4-(2-carboxyphenyl)-2-oxobut-3-enoic acid (CHEBI:49223) |
| IUPAC Name |
|---|
| 2-(3-carboxy-3-oxoprop-1-en-1-yl)benzoic acid |
| Synonyms | Source |
|---|---|
| 2'-Carboxybenzalpyruvate | ChemIDplus |
| 2-Cbap | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:85896-59-9 | ChemIDplus |